About hexadecyl N-diazocarbamate
hexadecyl N-diazocarbamate (PubChem CID 13247383) has the molecular formula C17H33N3O2
and a molecular weight of 311.47 g/mol. Its IUPAC name is hexadecyl N-diazocarbamate.
Molecular Properties
| Compound Name | hexadecyl N-diazocarbamate |
| PubChem CID | 13247383 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | hexadecyl N-diazocarbamate |
| SMILES | CCCCCCCCCCCCCCCCOC(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C17H33N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-17(21)19-20-18/h2-16H2,1H3 |
| InChIKey | VLPHXVPHCXBBIU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze hexadecyl N-diazocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecyl N-diazocarbamate?
The IUPAC name of hexadecyl N-diazocarbamate (CID 13247383) is hexadecyl N-diazocarbamate.
What is the SMILES notation for hexadecyl N-diazocarbamate?
The canonical SMILES for hexadecyl N-diazocarbamate is CCCCCCCCCCCCCCCCOC(=O)N=[N+]=[N-].
What is the InChIKey of hexadecyl N-diazocarbamate?
The InChIKey is VLPHXVPHCXBBIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-17(21)19-20-18/h2-16H2,1H3.
What are the key properties of hexadecyl N-diazocarbamate?
hexadecyl N-diazocarbamate has a molecular weight of 311.47 g/mol, XLogP of 6.91, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecyl N-diazocarbamate is sourced from PubChem (CID 13247383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).