C29H44N6P+ — CID 132500443
N-[[[1,3-di(propan-2-yl)benzimidazol-2-ylidene]amino]-propan-2-ylphosphanyl]-1,3-di(propan-2-yl)benzimidazol-3-ium-2-amine (PubChem CID 132500443) has the molecular formula C29H44N6P+ and a molecular weight of 507.69 g/mol. Its IUPAC name is N-[[[1,3-di(propan-2-yl)benzimidazol-2-ylidene]amino]-propan-2-ylphosphanyl]-1,3-di(propan-2-yl)benzimidazol-3-ium-2-amine.
| Compound Name | N-[[[1,3-di(propan-2-yl)benzimidazol-2-ylidene]amino]-propan-2-ylphosphanyl]-1,3-di(propan-2-yl)benzimidazol-3-ium-2-amine |
|---|---|
| PubChem CID | 132500443 |
| Molecular Formula | C29H44N6P+ |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.34 |
| IUPAC Name | N-[[[1,3-di(propan-2-yl)benzimidazol-2-ylidene]amino]-propan-2-ylphosphanyl]-1,3-di(propan-2-yl)benzimidazol-3-ium-2-amine |
| SMILES | CC(C)n1c(NP(N=c2n(C(C)C)c3ccccc3n2C(C)C)C(C)C)[n+](C(C)C)c2ccccc21 |
| InChI | InChI=1S/C29H43N6P/c1-19(2)32-24-15-11-12-16-25(24)33(20(3)4)28(32)30-36(23(9)10)31-29-34(21(5)6)26-17-13-14-18-27(26)35(29)22(7)8/h11-23H,1-10H3/p+1 |
| InChIKey | UIRGCKFFMGDDTC-UHFFFAOYSA-O |
| XLogP | 7.74 |
| TPSA | 43.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|