About 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine
1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine (PubChem CID 167077140) has the molecular formula C16H27N3S
and a molecular weight of 293.48 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine.
Molecular Properties
| Compound Name | 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine |
| PubChem CID | 167077140 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine |
| SMILES | CC(C)n1c(=NS(C)(C)C)n(C(C)C)c2ccccc21 |
| InChI | InChI=1S/C16H27N3S/c1-12(2)18-14-10-8-9-11-15(14)19(13(3)4)16(18)17-20(5,6)7/h8-13H,1-7H3 |
| InChIKey | SQKTXEDPWPJYCX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine?
The IUPAC name of 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine (CID 167077140) is 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine.
What is the SMILES notation for 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine?
The canonical SMILES for 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine is CC(C)n1c(=NS(C)(C)C)n(C(C)C)c2ccccc21.
What is the InChIKey of 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine?
The InChIKey is SQKTXEDPWPJYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3S/c1-12(2)18-14-10-8-9-11-15(14)19(13(3)4)16(18)17-20(5,6)7/h8-13H,1-7H3.
What are the key properties of 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine?
1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine has a molecular weight of 293.48 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-di(propan-2-yl)-N-(trimethyl-λ4-sulfanyl)benzimidazol-2-imine is sourced from PubChem (CID 167077140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).