C25H28N3P — CID 122386375
N-diphenylphosphanyl-1,3-di(propan-2-yl)benzimidazol-2-imine (PubChem CID 122386375) has the molecular formula C25H28N3P and a molecular weight of 401.49 g/mol. Its IUPAC name is N-diphenylphosphanyl-1,3-di(propan-2-yl)benzimidazol-2-imine.
| Compound Name | N-diphenylphosphanyl-1,3-di(propan-2-yl)benzimidazol-2-imine |
|---|---|
| PubChem CID | 122386375 |
| Molecular Formula | C25H28N3P |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-diphenylphosphanyl-1,3-di(propan-2-yl)benzimidazol-2-imine |
| SMILES | CC(C)n1c(=NP(c2ccccc2)c2ccccc2)n(C(C)C)c2ccccc21 |
| InChI | InChI=1S/C25H28N3P/c1-19(2)27-23-17-11-12-18-24(23)28(20(3)4)25(27)26-29(21-13-7-5-8-14-21)22-15-9-6-10-16-22/h5-20H,1-4H3 |
| InChIKey | DZZXWNWZZKRDKY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|