C32H56N8Si2 — CID 164987063
azido(trimethyl)silane;1,3-di(propan-2-yl)-2H-benzimidazole;1,3-di(propan-2-yl)-N-trimethylsilylbenzimidazol-2-imine (PubChem CID 164987063) has the molecular formula C32H56N8Si2 and a molecular weight of 609.03 g/mol. Its IUPAC name is azido(trimethyl)silane;1,3-di(propan-2-yl)-2H-benzimidazole;1,3-di(propan-2-yl)-N-trimethylsilylbenzimidazol-2-imine.
| Compound Name | azido(trimethyl)silane;1,3-di(propan-2-yl)-2H-benzimidazole;1,3-di(propan-2-yl)-N-trimethylsilylbenzimidazol-2-imine |
|---|---|
| PubChem CID | 164987063 |
| Molecular Formula | C32H56N8Si2 |
| Molecular Weight | 609.03 g/mol |
| Exact Mass | 608.42 |
| IUPAC Name | azido(trimethyl)silane;1,3-di(propan-2-yl)-2H-benzimidazole;1,3-di(propan-2-yl)-N-trimethylsilylbenzimidazol-2-imine |
| SMILES | CC(C)N1CN(C(C)C)c2ccccc21.CC(C)n1c(=N[Si](C)(C)C)n(C(C)C)c2ccccc21.C[Si](C)(C)N=[N+]=[N-] |
| InChI | InChI=1S/C16H27N3Si.C13H20N2.C3H9N3Si/c1-12(2)18-14-10-8-9-11-15(14)19(13(3)4)16(18)17-20(5,6)7;1-10(2)14-9-15(11(3)4)13-8-6-5-7-12(13)14;1-7(2,3)6-5-4/h8-13H,1-7H3;5-8,10-11H,9H2,1-4H3;1-3H3 |
| InChIKey | UYACWWDKXDPWQT-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 77.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.03 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|