C24H45N4PSi — CID 155708277
N-(butyl-tert-butyl-trimethylsilylimino-λ5-phosphanyl)-1,3-di(propan-2-yl)benzimidazol-2-imine (PubChem CID 155708277) has the molecular formula C24H45N4PSi and a molecular weight of 448.71 g/mol. Its IUPAC name is N-(butyl-tert-butyl-trimethylsilylimino-λ5-phosphanyl)-1,3-di(propan-2-yl)benzimidazol-2-imine.
| Compound Name | N-(butyl-tert-butyl-trimethylsilylimino-λ5-phosphanyl)-1,3-di(propan-2-yl)benzimidazol-2-imine |
|---|---|
| PubChem CID | 155708277 |
| Molecular Formula | C24H45N4PSi |
| Molecular Weight | 448.71 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | N-(butyl-tert-butyl-trimethylsilylimino-λ5-phosphanyl)-1,3-di(propan-2-yl)benzimidazol-2-imine |
| SMILES | CCCCP(N=c1n(C(C)C)c2ccccc2n1C(C)C)(=N[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H45N4PSi/c1-12-13-18-29(24(6,7)8,26-30(9,10)11)25-23-27(19(2)3)21-16-14-15-17-22(21)28(23)20(4)5/h14-17,19-20H,12-13,18H2,1-11H3 |
| InChIKey | LDGLFXUVAPVQDZ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.71 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|