About 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one
1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one (PubChem CID 21318563) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one.
Molecular Properties
| Compound Name | 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one |
| PubChem CID | 21318563 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one |
| SMILES | CC(C)N1c2ccccc2C(=O)C12CC2 |
| InChI | InChI=1S/C13H15NO/c1-9(2)14-11-6-4-3-5-10(11)12(15)13(14)7-8-13/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | AKRBIYMJLQYYTC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one?
The IUPAC name of 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one (CID 21318563) is 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one.
What is the SMILES notation for 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one?
The canonical SMILES for 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one is CC(C)N1c2ccccc2C(=O)C12CC2.
What is the InChIKey of 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one?
The InChIKey is AKRBIYMJLQYYTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c1-9(2)14-11-6-4-3-5-10(11)12(15)13(14)7-8-13/h3-6,9H,7-8H2,1-2H3.
What are the key properties of 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one?
1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one has a molecular weight of 201.27 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-propan-2-ylspiro[cyclopropane-1,2'-indole]-3'-one is sourced from PubChem (CID 21318563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).