C17H17NOS — CID 140668874
11-methylidene-5-propan-2-ylbenzo[b][1,4]benzothiazepin-6-one (PubChem CID 140668874) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 11-methylidene-5-propan-2-ylbenzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 11-methylidene-5-propan-2-ylbenzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 140668874 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 11-methylidene-5-propan-2-ylbenzo[b][1,4]benzothiazepin-6-one |
| SMILES | C=S1c2ccccc2C(=O)N(C(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H17NOS/c1-12(2)18-14-9-5-7-11-16(14)20(3)15-10-6-4-8-13(15)17(18)19/h4-12H,3H2,1-2H3 |
| InChIKey | BAUALJISNQUABN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|