C10H8KNO5S — CID 140883913
potassium 1-(1,3-dioxoisoindol-2-yl)ethanesulfonate (PubChem CID 140883913) has the molecular formula C10H8KNO5S and a molecular weight of 293.34 g/mol. Its IUPAC name is potassium 1-(1,3-dioxoisoindol-2-yl)ethanesulfonate.
| Compound Name | potassium 1-(1,3-dioxoisoindol-2-yl)ethanesulfonate |
|---|---|
| PubChem CID | 140883913 |
| Molecular Formula | C10H8KNO5S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | potassium 1-(1,3-dioxoisoindol-2-yl)ethanesulfonate |
| SMILES | CC(N1C(=O)c2ccccc2C1=O)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C10H9NO5S.K/c1-6(17(14,15)16)11-9(12)7-4-2-3-5-8(7)10(11)13;/h2-6H,1H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | HKONWMZLALRJHK-UHFFFAOYSA-M |
| XLogP | -2.82 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|