C17H14BrCl2N — CID 132500605
3-bromo-5-[2-(4-tert-butylphenyl)ethynyl]-2,6-dichloropyridine (PubChem CID 132500605) has the molecular formula C17H14BrCl2N and a molecular weight of 383.12 g/mol. Its IUPAC name is 3-bromo-5-[2-(4-tert-butylphenyl)ethynyl]-2,6-dichloropyridine.
| Compound Name | 3-bromo-5-[2-(4-tert-butylphenyl)ethynyl]-2,6-dichloropyridine |
|---|---|
| PubChem CID | 132500605 |
| Molecular Formula | C17H14BrCl2N |
| Molecular Weight | 383.12 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 3-bromo-5-[2-(4-tert-butylphenyl)ethynyl]-2,6-dichloropyridine |
| SMILES | CC(C)(C)c1ccc(C#Cc2cc(Br)c(Cl)nc2Cl)cc1 |
| InChI | InChI=1S/C17H14BrCl2N/c1-17(2,3)13-8-5-11(6-9-13)4-7-12-10-14(18)16(20)21-15(12)19/h5-6,8-10H,1-3H3 |
| InChIKey | UCLCIWPYWZTLRL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.12 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|