C20H22O5 — CID 132501325
5,6,7-trimethoxy-3-[(4-methoxyphenyl)methyl]-2H-chromene (PubChem CID 132501325) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is 5,6,7-trimethoxy-3-[(4-methoxyphenyl)methyl]-2H-chromene.
| Compound Name | 5,6,7-trimethoxy-3-[(4-methoxyphenyl)methyl]-2H-chromene |
|---|---|
| PubChem CID | 132501325 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 5,6,7-trimethoxy-3-[(4-methoxyphenyl)methyl]-2H-chromene |
| SMILES | COc1ccc(CC2=Cc3c(cc(OC)c(OC)c3OC)OC2)cc1 |
| InChI | InChI=1S/C20H22O5/c1-21-15-7-5-13(6-8-15)9-14-10-16-17(25-12-14)11-18(22-2)20(24-4)19(16)23-3/h5-8,10-11H,9,12H2,1-4H3 |
| InChIKey | MBDIZYMZEDJPEM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |