C23H29O8P — CID 132557913
[5,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-2H-chromen-4-yl] diethyl phosphate (PubChem CID 132557913) has the molecular formula C23H29O8P and a molecular weight of 464.45 g/mol. Its IUPAC name is [5,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-2H-chromen-4-yl] diethyl phosphate.
| Compound Name | [5,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-2H-chromen-4-yl] diethyl phosphate |
|---|---|
| PubChem CID | 132557913 |
| Molecular Formula | C23H29O8P |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [5,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-2H-chromen-4-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC1=C(Cc2ccc(OC)cc2)COc2cc(OC)cc(OC)c21 |
| InChI | InChI=1S/C23H29O8P/c1-6-29-32(24,30-7-2)31-23-17(12-16-8-10-18(25-3)11-9-16)15-28-21-14-19(26-4)13-20(27-5)22(21)23/h8-11,13-14H,6-7,12,15H2,1-5H3 |
| InChIKey | YRESUEWVHPQHBV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|