C32H32N2O3 — CID 132505142
(5S,6R,7S)-1-tert-butyl-6-[(E)-2-(4-methoxyphenyl)ethenyl]-3,7-diphenyl-2,3-diazaspiro[4.4]non-1-ene-4,9-dione (PubChem CID 132505142) has the molecular formula C32H32N2O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is (5S,6R,7S)-1-tert-butyl-6-[(E)-2-(4-methoxyphenyl)ethenyl]-3,7-diphenyl-2,3-diazaspiro[4.4]non-1-ene-4,9-dione.
| Compound Name | (5S,6R,7S)-1-tert-butyl-6-[(E)-2-(4-methoxyphenyl)ethenyl]-3,7-diphenyl-2,3-diazaspiro[4.4]non-1-ene-4,9-dione |
|---|---|
| PubChem CID | 132505142 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | (5S,6R,7S)-1-tert-butyl-6-[(E)-2-(4-methoxyphenyl)ethenyl]-3,7-diphenyl-2,3-diazaspiro[4.4]non-1-ene-4,9-dione |
| SMILES | COc1ccc(/C=C/[C@@H]2[C@@H](c3ccccc3)CC(=O)[C@]23C(=O)N(c2ccccc2)N=C3C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H32N2O3/c1-31(2,3)29-32(30(36)34(33-29)24-13-9-6-10-14-24)27(20-17-22-15-18-25(37-4)19-16-22)26(21-28(32)35)23-11-7-5-8-12-23/h5-20,26-27H,21H2,1-4H3/b20-17+/t26-,27-,32-/m1/s1 |
| InChIKey | WDRHSIXXFRZKLM-KCYOWPASSA-N |
| XLogP | 6.52 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|