C31H29ClN2O2 — CID 132505139
(5S,6R,7S)-1-tert-butyl-7-(4-chlorophenyl)-3-phenyl-6-[(E)-2-phenylethenyl]-2,3-diazaspiro[4.4]non-1-ene-4,9-dione (PubChem CID 132505139) has the molecular formula C31H29ClN2O2 and a molecular weight of 497.04 g/mol. Its IUPAC name is (5S,6R,7S)-1-tert-butyl-7-(4-chlorophenyl)-3-phenyl-6-[(E)-2-phenylethenyl]-2,3-diazaspiro[4.4]non-1-ene-4,9-dione.
| Compound Name | (5S,6R,7S)-1-tert-butyl-7-(4-chlorophenyl)-3-phenyl-6-[(E)-2-phenylethenyl]-2,3-diazaspiro[4.4]non-1-ene-4,9-dione |
|---|---|
| PubChem CID | 132505139 |
| Molecular Formula | C31H29ClN2O2 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | (5S,6R,7S)-1-tert-butyl-7-(4-chlorophenyl)-3-phenyl-6-[(E)-2-phenylethenyl]-2,3-diazaspiro[4.4]non-1-ene-4,9-dione |
| SMILES | CC(C)(C)C1=NN(c2ccccc2)C(=O)[C@]12C(=O)C[C@H](c1ccc(Cl)cc1)[C@H]2/C=C/c1ccccc1 |
| InChI | InChI=1S/C31H29ClN2O2/c1-30(2,3)28-31(29(36)34(33-28)24-12-8-5-9-13-24)26(19-14-21-10-6-4-7-11-21)25(20-27(31)35)22-15-17-23(32)18-16-22/h4-19,25-26H,20H2,1-3H3/b19-14+/t25-,26-,31-/m1/s1 |
| InChIKey | NHTBKHQEJHQYRI-UMGYAGDDSA-N |
| XLogP | 7.16 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|