C29H29NO — CID 132505249
5-benzyl-6a,8,8-trimethyl-10-phenyl-7,9-dihydrophenanthridin-6-one (PubChem CID 132505249) has the molecular formula C29H29NO and a molecular weight of 407.56 g/mol. Its IUPAC name is 5-benzyl-6a,8,8-trimethyl-10-phenyl-7,9-dihydrophenanthridin-6-one.
| Compound Name | 5-benzyl-6a,8,8-trimethyl-10-phenyl-7,9-dihydrophenanthridin-6-one |
|---|---|
| PubChem CID | 132505249 |
| Molecular Formula | C29H29NO |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 5-benzyl-6a,8,8-trimethyl-10-phenyl-7,9-dihydrophenanthridin-6-one |
| SMILES | CC1(C)CC(c2ccccc2)=C2c3ccccc3N(Cc3ccccc3)C(=O)C2(C)C1 |
| InChI | InChI=1S/C29H29NO/c1-28(2)18-24(22-14-8-5-9-15-22)26-23-16-10-11-17-25(23)30(27(31)29(26,3)20-28)19-21-12-6-4-7-13-21/h4-17H,18-20H2,1-3H3 |
| InChIKey | ZSPPCLCRRUSMGR-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|