C27H36N2OSi — CID 139188257
(4aS)-6-benzyl-2,2,4a-trimethyl-3,3-di(propan-2-yl)-4H-[1,3]azasilino[5,6-c]quinolin-5-one (PubChem CID 139188257) has the molecular formula C27H36N2OSi and a molecular weight of 432.68 g/mol. Its IUPAC name is (4aS)-6-benzyl-2,2,4a-trimethyl-3,3-di(propan-2-yl)-4H-[1,3]azasilino[5,6-c]quinolin-5-one.
| Compound Name | (4aS)-6-benzyl-2,2,4a-trimethyl-3,3-di(propan-2-yl)-4H-[1,3]azasilino[5,6-c]quinolin-5-one |
|---|---|
| PubChem CID | 139188257 |
| Molecular Formula | C27H36N2OSi |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | (4aS)-6-benzyl-2,2,4a-trimethyl-3,3-di(propan-2-yl)-4H-[1,3]azasilino[5,6-c]quinolin-5-one |
| SMILES | CC(C)[Si]1(C(C)C)C[C@]2(C)C(=O)N(Cc3ccccc3)c3ccccc3C2=NC1(C)C |
| InChI | InChI=1S/C27H36N2OSi/c1-19(2)31(20(3)4)18-27(7)24(28-26(31,5)6)22-15-11-12-16-23(22)29(25(27)30)17-21-13-9-8-10-14-21/h8-16,19-20H,17-18H2,1-7H3/t27-/m0/s1 |
| InChIKey | RCGWEFSCEAFMDF-MHZLTWQESA-N |
| XLogP | 6.63 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|