C17H21NO6 — CID 132505420
(1S,10S)-4,9,14,14-tetramethoxy-9-azatricyclo[8.3.1.02,7]tetradeca-2(7),3,5-triene-8,12-dione (PubChem CID 132505420) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is (1S,10S)-4,9,14,14-tetramethoxy-9-azatricyclo[8.3.1.02,7]tetradeca-2(7),3,5-triene-8,12-dione.
| Compound Name | (1S,10S)-4,9,14,14-tetramethoxy-9-azatricyclo[8.3.1.02,7]tetradeca-2(7),3,5-triene-8,12-dione |
|---|---|
| PubChem CID | 132505420 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (1S,10S)-4,9,14,14-tetramethoxy-9-azatricyclo[8.3.1.02,7]tetradeca-2(7),3,5-triene-8,12-dione |
| SMILES | COc1ccc2c(c1)[C@@H]1CC(=O)C[C@H](N(OC)C2=O)C1(OC)OC |
| InChI | InChI=1S/C17H21NO6/c1-21-11-5-6-12-13(9-11)14-7-10(19)8-15(17(14,22-2)23-3)18(24-4)16(12)20/h5-6,9,14-15H,7-8H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | WHDVRDTUHOIKRI-GJZGRUSLSA-N |
| XLogP | 1.52 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|