C16H13BrO5 — CID 132510243
phenyl 3-(1,3-benzodioxol-5-yl)-2-bromo-3-hydroxypropanoate (PubChem CID 132510243) has the molecular formula C16H13BrO5 and a molecular weight of 365.18 g/mol. Its IUPAC name is phenyl 3-(1,3-benzodioxol-5-yl)-2-bromo-3-hydroxypropanoate.
| Compound Name | phenyl 3-(1,3-benzodioxol-5-yl)-2-bromo-3-hydroxypropanoate |
|---|---|
| PubChem CID | 132510243 |
| Molecular Formula | C16H13BrO5 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | phenyl 3-(1,3-benzodioxol-5-yl)-2-bromo-3-hydroxypropanoate |
| SMILES | O=C(Oc1ccccc1)C(Br)C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13BrO5/c17-14(16(19)22-11-4-2-1-3-5-11)15(18)10-6-7-12-13(8-10)21-9-20-12/h1-8,14-15,18H,9H2 |
| InChIKey | QGGNEYWNEFVXPJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|