C19H31NO3 — CID 132518523
[3-(4-methylcyclohex-3-en-1-yl)-1-oxo-1-(pentylamino)butan-2-yl] prop-2-enoate (PubChem CID 132518523) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is [3-(4-methylcyclohex-3-en-1-yl)-1-oxo-1-(pentylamino)butan-2-yl] prop-2-enoate.
| Compound Name | [3-(4-methylcyclohex-3-en-1-yl)-1-oxo-1-(pentylamino)butan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 132518523 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | [3-(4-methylcyclohex-3-en-1-yl)-1-oxo-1-(pentylamino)butan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C(=O)NCCCCC)C(C)C1CC=C(C)CC1 |
| InChI | InChI=1S/C19H31NO3/c1-5-7-8-13-20-19(22)18(23-17(21)6-2)15(4)16-11-9-14(3)10-12-16/h6,9,15-16,18H,2,5,7-8,10-13H2,1,3-4H3,(H,20,22) |
| InChIKey | IMOVTGDVCDHLAY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|