C19H13Cl2NO4 — CID 132518875
(2,2-dichloro-1-naphthalen-2-yl-2-nitroethyl) benzoate (PubChem CID 132518875) has the molecular formula C19H13Cl2NO4 and a molecular weight of 390.22 g/mol. Its IUPAC name is (2,2-dichloro-1-naphthalen-2-yl-2-nitroethyl) benzoate.
| Compound Name | (2,2-dichloro-1-naphthalen-2-yl-2-nitroethyl) benzoate |
|---|---|
| PubChem CID | 132518875 |
| Molecular Formula | C19H13Cl2NO4 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | (2,2-dichloro-1-naphthalen-2-yl-2-nitroethyl) benzoate |
| SMILES | O=C(OC(c1ccc2ccccc2c1)C(Cl)(Cl)[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C19H13Cl2NO4/c20-19(21,22(24)25)17(26-18(23)14-7-2-1-3-8-14)16-11-10-13-6-4-5-9-15(13)12-16/h1-12,17H |
| InChIKey | TVEGDPSCJSRWPI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|