C17H20N2O3 — CID 132520336
ethyl (8S,14S,15S)-8-hydroxy-14-methyl-1,11-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-2,4,6,12-tetraene-13-carboxylate (PubChem CID 132520336) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is ethyl (8S,14S,15S)-8-hydroxy-14-methyl-1,11-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-2,4,6,12-tetraene-13-carboxylate.
| Compound Name | ethyl (8S,14S,15S)-8-hydroxy-14-methyl-1,11-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-2,4,6,12-tetraene-13-carboxylate |
|---|---|
| PubChem CID | 132520336 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | ethyl (8S,14S,15S)-8-hydroxy-14-methyl-1,11-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-2,4,6,12-tetraene-13-carboxylate |
| SMILES | CCOC(=O)C1=CN2CC[C@]3(O)c4ccccc4N([C@H]1C)[C@H]23 |
| InChI | InChI=1S/C17H20N2O3/c1-3-22-15(20)12-10-18-9-8-17(21)13-6-4-5-7-14(13)19(11(12)2)16(17)18/h4-7,10-11,16,21H,3,8-9H2,1-2H3/t11-,16-,17-/m0/s1 |
| InChIKey | VAAAQKDVVWRLEJ-GOPGUHFVSA-N |
| XLogP | 1.58 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |