C19H24N4O4S2 — CID 132520686
4-methyl-N'-[6-methyl-2-(4-methylphenyl)sulfonyl-4,5-dihydro-3H-pyridazin-3-yl]benzenesulfonohydrazide (PubChem CID 132520686) has the molecular formula C19H24N4O4S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-methyl-N'-[6-methyl-2-(4-methylphenyl)sulfonyl-4,5-dihydro-3H-pyridazin-3-yl]benzenesulfonohydrazide.
| Compound Name | 4-methyl-N'-[6-methyl-2-(4-methylphenyl)sulfonyl-4,5-dihydro-3H-pyridazin-3-yl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 132520686 |
| Molecular Formula | C19H24N4O4S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-methyl-N'-[6-methyl-2-(4-methylphenyl)sulfonyl-4,5-dihydro-3H-pyridazin-3-yl]benzenesulfonohydrazide |
| SMILES | CC1=NN(S(=O)(=O)c2ccc(C)cc2)C(NNS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C19H24N4O4S2/c1-14-4-9-17(10-5-14)28(24,25)22-20-19-13-8-16(3)21-23(19)29(26,27)18-11-6-15(2)7-12-18/h4-7,9-12,19-20,22H,8,13H2,1-3H3 |
| InChIKey | BPIMMZHIOSOPNW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|