C12H15N3O4S — CID 155813594
N'-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carbohydrazide (PubChem CID 155813594) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N'-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carbohydrazide.
| Compound Name | N'-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 155813594 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N'-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)C2CCC(=O)N2)cc1 |
| InChI | InChI=1S/C12H15N3O4S/c1-8-2-4-9(5-3-8)20(18,19)15-14-12(17)10-6-7-11(16)13-10/h2-5,10,15H,6-7H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | JHZKWBLMEQJHGU-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|