C24H23F3N4O4S2 — CID 132570443
4-methyl-N'-[2-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-3-yl]benzenesulfonohydrazide (PubChem CID 132570443) has the molecular formula C24H23F3N4O4S2 and a molecular weight of 552.60 g/mol. Its IUPAC name is 4-methyl-N'-[2-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-3-yl]benzenesulfonohydrazide.
| Compound Name | 4-methyl-N'-[2-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-3-yl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 132570443 |
| Molecular Formula | C24H23F3N4O4S2 |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 4-methyl-N'-[2-(4-methylphenyl)sulfonyl-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-3-yl]benzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC2CC(c3ccc(C(F)(F)F)cc3)=NN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23F3N4O4S2/c1-16-3-11-20(12-4-16)36(32,33)30-28-23-15-22(18-7-9-19(10-8-18)24(25,26)27)29-31(23)37(34,35)21-13-5-17(2)6-14-21/h3-14,23,28,30H,15H2,1-2H3 |
| InChIKey | LGRPMRCMQFYUJN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|