C15H20O — CID 132521156
(1S)-1-[(1R,2S)-1,2-dimethyl-3-methylidenecyclopropyl]-3-phenylpropan-1-ol (PubChem CID 132521156) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (1S)-1-[(1R,2S)-1,2-dimethyl-3-methylidenecyclopropyl]-3-phenylpropan-1-ol.
| Compound Name | (1S)-1-[(1R,2S)-1,2-dimethyl-3-methylidenecyclopropyl]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 132521156 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1S)-1-[(1R,2S)-1,2-dimethyl-3-methylidenecyclopropyl]-3-phenylpropan-1-ol |
| SMILES | C=C1[C@H](C)[C@@]1(C)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C15H20O/c1-11-12(2)15(11,3)14(16)10-9-13-7-5-4-6-8-13/h4-8,12,14,16H,1,9-10H2,2-3H3/t12-,14-,15-/m0/s1 |
| InChIKey | CKADZSKZJQULNO-QEJZJMRPSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|