C32H39NO5S — CID 132521820
tert-butyl (1S,3S,3aS,8aS)-3a-(2,2-dimethylpropanoyl)-2-(4-methylphenyl)sulfonyl-3-phenyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate (PubChem CID 132521820) has the molecular formula C32H39NO5S and a molecular weight of 549.73 g/mol. Its IUPAC name is tert-butyl (1S,3S,3aS,8aS)-3a-(2,2-dimethylpropanoyl)-2-(4-methylphenyl)sulfonyl-3-phenyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (1S,3S,3aS,8aS)-3a-(2,2-dimethylpropanoyl)-2-(4-methylphenyl)sulfonyl-3-phenyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 132521820 |
| Molecular Formula | C32H39NO5S |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | tert-butyl (1S,3S,3aS,8aS)-3a-(2,2-dimethylpropanoyl)-2-(4-methylphenyl)sulfonyl-3-phenyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](C(=O)OC(C)(C)C)[C@H]3CC=CC=C[C@@]3(C(=O)C(C)(C)C)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C32H39NO5S/c1-22-17-19-24(20-18-22)39(36,37)33-26(28(34)38-31(5,6)7)25-16-12-9-13-21-32(25,29(35)30(2,3)4)27(33)23-14-10-8-11-15-23/h8-15,17-21,25-27H,16H2,1-7H3/t25-,26+,27+,32+/m1/s1 |
| InChIKey | LOUGIKJKFRMEQH-ZPCULFKHSA-N |
| XLogP | 6.18 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |