C26H27NO5S — CID 132521824
methyl (1S,3S,3aS,8aS)-3a-acetyl-2-(4-methylphenyl)sulfonyl-3-phenyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate (PubChem CID 132521824) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is methyl (1S,3S,3aS,8aS)-3a-acetyl-2-(4-methylphenyl)sulfonyl-3-phenyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate.
| Compound Name | methyl (1S,3S,3aS,8aS)-3a-acetyl-2-(4-methylphenyl)sulfonyl-3-phenyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 132521824 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | methyl (1S,3S,3aS,8aS)-3a-acetyl-2-(4-methylphenyl)sulfonyl-3-phenyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2CC=CC=C[C@@]2(C(C)=O)[C@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H27NO5S/c1-18-13-15-21(16-14-18)33(30,31)27-23(25(29)32-3)22-12-8-5-9-17-26(22,19(2)28)24(27)20-10-6-4-7-11-20/h4-11,13-17,22-24H,12H2,1-3H3/t22-,23+,24+,26+/m1/s1 |
| InChIKey | FZNWCKSBJOTBJV-APFRJGHOSA-N |
| XLogP | 3.99 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |