C42H55NO12 — CID 132523270
tert-butyl N-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-ylmethyl)-N-[[4-(2-prop-2-ynoxyethoxy)phenyl]methyl]carbamate (PubChem CID 132523270) has the molecular formula C42H55NO12 and a molecular weight of 765.90 g/mol. Its IUPAC name is tert-butyl N-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-ylmethyl)-N-[[4-(2-prop-2-ynoxyethoxy)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-ylmethyl)-N-[[4-(2-prop-2-ynoxyethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 132523270 |
| Molecular Formula | C42H55NO12 |
| Molecular Weight | 765.90 g/mol |
| Exact Mass | 765.37 |
| IUPAC Name | tert-butyl N-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-ylmethyl)-N-[[4-(2-prop-2-ynoxyethoxy)phenyl]methyl]carbamate |
| SMILES | C#CCOCCOc1ccc(CN(Cc2ccc3c(c2)OCCOCCOCCOc2ccccc2OCCOCCOCCO3)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C42H55NO12/c1-5-16-45-21-26-50-36-13-10-34(11-14-36)32-43(41(44)55-42(2,3)4)33-35-12-15-39-40(31-35)54-30-25-49-20-19-47-23-28-52-38-9-7-6-8-37(38)51-27-22-46-17-18-48-24-29-53-39/h1,6-15,31H,16-30,32-33H2,2-4H3 |
| InChIKey | YJASLYWGBYUHJD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 121.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.90 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|