C23H26O6S — CID 132523819
dimethyl 3-(benzenesulfonyl)-4-(cyclopentylidenemethyl)-5-methylidenecyclohex-3-ene-1,1-dicarboxylate (PubChem CID 132523819) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is dimethyl 3-(benzenesulfonyl)-4-(cyclopentylidenemethyl)-5-methylidenecyclohex-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(benzenesulfonyl)-4-(cyclopentylidenemethyl)-5-methylidenecyclohex-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 132523819 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | dimethyl 3-(benzenesulfonyl)-4-(cyclopentylidenemethyl)-5-methylidenecyclohex-3-ene-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)CC(S(=O)(=O)c2ccccc2)=C1C=C1CCCC1 |
| InChI | InChI=1S/C23H26O6S/c1-16-14-23(21(24)28-2,22(25)29-3)15-20(19(16)13-17-9-7-8-10-17)30(26,27)18-11-5-4-6-12-18/h4-6,11-13H,1,7-10,14-15H2,2-3H3 |
| InChIKey | ABAXMYMIROWREF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|