C25H26O6S — CID 102187801
dimethyl 3-(benzenesulfonyl)-5-methyl-4-[(E)-2-phenylethenyl]cyclohex-3-ene-1,1-dicarboxylate (PubChem CID 102187801) has the molecular formula C25H26O6S and a molecular weight of 454.54 g/mol. Its IUPAC name is dimethyl 3-(benzenesulfonyl)-5-methyl-4-[(E)-2-phenylethenyl]cyclohex-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(benzenesulfonyl)-5-methyl-4-[(E)-2-phenylethenyl]cyclohex-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102187801 |
| Molecular Formula | C25H26O6S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | dimethyl 3-(benzenesulfonyl)-5-methyl-4-[(E)-2-phenylethenyl]cyclohex-3-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(S(=O)(=O)c2ccccc2)=C(/C=C/c2ccccc2)C(C)C1 |
| InChI | InChI=1S/C25H26O6S/c1-18-16-25(23(26)30-2,24(27)31-3)17-22(32(28,29)20-12-8-5-9-13-20)21(18)15-14-19-10-6-4-7-11-19/h4-15,18H,16-17H2,1-3H3/b15-14+ |
| InChIKey | PEBRUBVTGVQARP-CCEZHUSRSA-N |
| XLogP | 4.19 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|