C21H23NO5S — CID 23161122
[4-benzylidene-1-(3-methoxyphenyl)cyclohexanecarbonyl]sulfamic acid (PubChem CID 23161122) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is [4-benzylidene-1-(3-methoxyphenyl)cyclohexanecarbonyl]sulfamic acid.
| Compound Name | [4-benzylidene-1-(3-methoxyphenyl)cyclohexanecarbonyl]sulfamic acid |
|---|---|
| PubChem CID | 23161122 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [4-benzylidene-1-(3-methoxyphenyl)cyclohexanecarbonyl]sulfamic acid |
| SMILES | COc1cccc(C2(C(=O)NS(=O)(=O)O)CCC(=Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H23NO5S/c1-27-19-9-5-8-18(15-19)21(20(23)22-28(24,25)26)12-10-17(11-13-21)14-16-6-3-2-4-7-16/h2-9,14-15H,10-13H2,1H3,(H,22,23)(H,24,25,26)/b17-14- |
| InChIKey | HNCUTIRRSLRAED-VKAVYKQESA-N |
| XLogP | 3.51 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|