C20H24ClN2O6S- — CID 23161186
N-[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate;hydrochloride (PubChem CID 23161186) has the molecular formula C20H24ClN2O6S- and a molecular weight of 455.94 g/mol. Its IUPAC name is N-[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate;hydrochloride.
| Compound Name | N-[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate;hydrochloride |
|---|---|
| PubChem CID | 23161186 |
| Molecular Formula | C20H24ClN2O6S- |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N-[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidine-4-carbonyl]sulfamate;hydrochloride |
| SMILES | COc1cccc(C2(C(=O)NS(=O)(=O)[O-])CCN(c3ccccc3OC)CC2)c1.Cl |
| InChI | InChI=1S/C20H24N2O6S.ClH/c1-27-16-7-5-6-15(14-16)20(19(23)21-29(24,25)26)10-12-22(13-11-20)17-8-3-4-9-18(17)28-2;/h3-9,14H,10-13H2,1-2H3,(H,21,23)(H,24,25,26);1H/p-1 |
| InChIKey | BXMTUEQRQYKHHI-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|