C21H26N2O6S — CID 87741441
sulfamoyl 2-[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]acetate (PubChem CID 87741441) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is sulfamoyl 2-[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]acetate.
| Compound Name | sulfamoyl 2-[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 87741441 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | sulfamoyl 2-[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]acetate |
| SMILES | COc1cccc(C2(CC(=O)OS(N)(=O)=O)CCN(c3ccccc3OC)CC2)c1 |
| InChI | InChI=1S/C21H26N2O6S/c1-27-17-7-5-6-16(14-17)21(15-20(24)29-30(22,25)26)10-12-23(13-11-21)18-8-3-4-9-19(18)28-2/h3-9,14H,10-13,15H2,1-2H3,(H2,22,25,26) |
| InChIKey | KLKZVCRUGFMNDE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |