C33H44N4O3 — CID 44590614
1-[3-amino-2,6-di(propan-2-yl)phenyl]-3-[[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]methyl]urea (PubChem CID 44590614) has the molecular formula C33H44N4O3 and a molecular weight of 544.74 g/mol. Its IUPAC name is 1-[3-amino-2,6-di(propan-2-yl)phenyl]-3-[[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]methyl]urea.
| Compound Name | 1-[3-amino-2,6-di(propan-2-yl)phenyl]-3-[[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]methyl]urea |
|---|---|
| PubChem CID | 44590614 |
| Molecular Formula | C33H44N4O3 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 1-[3-amino-2,6-di(propan-2-yl)phenyl]-3-[[1-(2-methoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]methyl]urea |
| SMILES | COc1cccc(C2(CNC(=O)Nc3c(C(C)C)ccc(N)c3C(C)C)CCN(c3ccccc3OC)CC2)c1 |
| InChI | InChI=1S/C33H44N4O3/c1-22(2)26-14-15-27(34)30(23(3)4)31(26)36-32(38)35-21-33(24-10-9-11-25(20-24)39-5)16-18-37(19-17-33)28-12-7-8-13-29(28)40-6/h7-15,20,22-23H,16-19,21,34H2,1-6H3,(H2,35,36,38) |
| InChIKey | VIPOOXMKVTVQBU-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|