C32H40N2NaO6S — CID 172700372
CID 172700372 (PubChem CID 172700372) has the molecular formula C32H40N2NaO6S and a molecular weight of 603.74 g/mol.
| Compound Name | CID 172700372 |
|---|---|
| PubChem CID | 172700372 |
| Molecular Formula | C32H40N2NaO6S |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | — |
| SMILES | COc1cccc(C2(C(=O)NS(=O)(=O)Oc3c(C(C)C)cccc3C(C)C)CCN(c3ccccc3OC)CC2)c1.[Na] |
| InChI | InChI=1S/C32H40N2O6S.Na/c1-22(2)26-13-10-14-27(23(3)4)30(26)40-41(36,37)33-31(35)32(24-11-9-12-25(21-24)38-5)17-19-34(20-18-32)28-15-7-8-16-29(28)39-6;/h7-16,21-23H,17-20H2,1-6H3,(H,33,35); |
| InChIKey | CWOXFCCQFOXKQF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |