C31H40N4O6S — CID 46202247
[2,6-di(propan-2-yl)phenyl] N-[4-[3-(3-hydroxypropoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carbonyl]sulfamate (PubChem CID 46202247) has the molecular formula C31H40N4O6S and a molecular weight of 596.75 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] N-[4-[3-(3-hydroxypropoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carbonyl]sulfamate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] N-[4-[3-(3-hydroxypropoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carbonyl]sulfamate |
|---|---|
| PubChem CID | 46202247 |
| Molecular Formula | C31H40N4O6S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] N-[4-[3-(3-hydroxypropoxy)phenyl]-1-pyrimidin-2-ylpiperidine-4-carbonyl]sulfamate |
| SMILES | CC(C)c1cccc(C(C)C)c1OS(=O)(=O)NC(=O)C1(c2cccc(OCCCO)c2)CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C31H40N4O6S/c1-22(2)26-11-6-12-27(23(3)4)28(26)41-42(38,39)34-29(37)31(24-9-5-10-25(21-24)40-20-8-19-36)13-17-35(18-14-31)30-32-15-7-16-33-30/h5-7,9-12,15-16,21-23,36H,8,13-14,17-20H2,1-4H3,(H,34,37) |
| InChIKey | HLLWZRXDMXOSRW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|