C23H24ClN5O4S — CID 23161173
4-chloro-N-[[4-(3-methoxyphenyl)-1-pyrimidin-2-ylpiperidin-4-yl]sulfamoyl]benzamide (PubChem CID 23161173) has the molecular formula C23H24ClN5O4S and a molecular weight of 502.00 g/mol. Its IUPAC name is 4-chloro-N-[[4-(3-methoxyphenyl)-1-pyrimidin-2-ylpiperidin-4-yl]sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-[[4-(3-methoxyphenyl)-1-pyrimidin-2-ylpiperidin-4-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 23161173 |
| Molecular Formula | C23H24ClN5O4S |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 4-chloro-N-[[4-(3-methoxyphenyl)-1-pyrimidin-2-ylpiperidin-4-yl]sulfamoyl]benzamide |
| SMILES | COc1cccc(C2(NS(=O)(=O)NC(=O)c3ccc(Cl)cc3)CCN(c3ncccn3)CC2)c1 |
| InChI | InChI=1S/C23H24ClN5O4S/c1-33-20-5-2-4-18(16-20)23(10-14-29(15-11-23)22-25-12-3-13-26-22)28-34(31,32)27-21(30)17-6-8-19(24)9-7-17/h2-9,12-13,16,28H,10-11,14-15H2,1H3,(H,27,30) |
| InChIKey | GXMWNYUWBYDRKC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |