C22H20N4O3 — CID 132524792
4-(3-diazo-2-oxopropyl)-2-[(4-methoxyphenyl)methyl]-3,4-dihydropyrazino[1,2-a]indol-1-one (PubChem CID 132524792) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-(3-diazo-2-oxopropyl)-2-[(4-methoxyphenyl)methyl]-3,4-dihydropyrazino[1,2-a]indol-1-one.
| Compound Name | 4-(3-diazo-2-oxopropyl)-2-[(4-methoxyphenyl)methyl]-3,4-dihydropyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 132524792 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(3-diazo-2-oxopropyl)-2-[(4-methoxyphenyl)methyl]-3,4-dihydropyrazino[1,2-a]indol-1-one |
| SMILES | COc1ccc(CN2CC(CC(=O)C=[N+]=[N-])n3c(cc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C22H20N4O3/c1-29-19-8-6-15(7-9-19)13-25-14-17(11-18(27)12-24-23)26-20-5-3-2-4-16(20)10-21(26)22(25)28/h2-10,12,17H,11,13-14H2,1H3 |
| InChIKey | RKVWPWHCNMQVDX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|