C24H24N2O3 — CID 101356806
2-[(4-methoxyphenyl)methyl]-10-methyl-4-prop-2-enyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione (PubChem CID 101356806) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-10-methyl-4-prop-2-enyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-10-methyl-4-prop-2-enyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione |
|---|---|
| PubChem CID | 101356806 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-10-methyl-4-prop-2-enyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione |
| SMILES | C=CCC1CN(Cc2ccc(OC)cc2)C(=O)c2c(c3ccccc3n2C)C1=O |
| InChI | InChI=1S/C24H24N2O3/c1-4-7-17-15-26(14-16-10-12-18(29-3)13-11-16)24(28)22-21(23(17)27)19-8-5-6-9-20(19)25(22)2/h4-6,8-13,17H,1,7,14-15H2,2-3H3 |
| InChIKey | NUOANIAGCWDNCR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|