C27H30N2O3 — CID 170859851
4-hex-5-enyl-2-[(4-methoxyphenyl)methyl]-10-methyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione (PubChem CID 170859851) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 4-hex-5-enyl-2-[(4-methoxyphenyl)methyl]-10-methyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione.
| Compound Name | 4-hex-5-enyl-2-[(4-methoxyphenyl)methyl]-10-methyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione |
|---|---|
| PubChem CID | 170859851 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 4-hex-5-enyl-2-[(4-methoxyphenyl)methyl]-10-methyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione |
| SMILES | C=CCCCCC1CN(Cc2ccc(OC)cc2)C(=O)c2c(c3ccccc3n2C)C1=O |
| InChI | InChI=1S/C27H30N2O3/c1-4-5-6-7-10-20-18-29(17-19-13-15-21(32-3)16-14-19)27(31)25-24(26(20)30)22-11-8-9-12-23(22)28(25)2/h4,8-9,11-16,20H,1,5-7,10,17-18H2,2-3H3 |
| InChIKey | BJPWRSMKPKENIT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|