C17H17BrN2O2 — CID 170859951
4-bromo-2-but-3-enyl-10-methyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione (PubChem CID 170859951) has the molecular formula C17H17BrN2O2 and a molecular weight of 361.24 g/mol. Its IUPAC name is 4-bromo-2-but-3-enyl-10-methyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione.
| Compound Name | 4-bromo-2-but-3-enyl-10-methyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione |
|---|---|
| PubChem CID | 170859951 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 4-bromo-2-but-3-enyl-10-methyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione |
| SMILES | C=CCCN1CC(Br)C(=O)c2c(n(C)c3ccccc23)C1=O |
| InChI | InChI=1S/C17H17BrN2O2/c1-3-4-9-20-10-12(18)16(21)14-11-7-5-6-8-13(11)19(2)15(14)17(20)22/h3,5-8,12H,1,4,9-10H2,2H3 |
| InChIKey | PMTCOJDYDLEYEQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|