C14H13BrN2O2 — CID 154270514
3-bromo-2,10-dimethyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione (PubChem CID 154270514) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is 3-bromo-2,10-dimethyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione.
| Compound Name | 3-bromo-2,10-dimethyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione |
|---|---|
| PubChem CID | 154270514 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 3-bromo-2,10-dimethyl-3,4-dihydroazepino[3,4-b]indole-1,5-dione |
| SMILES | CN1C(=O)c2c(c3ccccc3n2C)C(=O)CC1Br |
| InChI | InChI=1S/C14H13BrN2O2/c1-16-9-6-4-3-5-8(9)12-10(18)7-11(15)17(2)14(19)13(12)16/h3-6,11H,7H2,1-2H3 |
| InChIKey | SJXSHDPONLAAAJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|