C28H30N2O3 — CID 101356800
4-but-3-enyl-2-[(4-methoxyphenyl)methyl]-10-methyl-4-prop-2-enyl-3H-azepino[3,4-b]indole-1,5-dione (PubChem CID 101356800) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-but-3-enyl-2-[(4-methoxyphenyl)methyl]-10-methyl-4-prop-2-enyl-3H-azepino[3,4-b]indole-1,5-dione.
| Compound Name | 4-but-3-enyl-2-[(4-methoxyphenyl)methyl]-10-methyl-4-prop-2-enyl-3H-azepino[3,4-b]indole-1,5-dione |
|---|---|
| PubChem CID | 101356800 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-but-3-enyl-2-[(4-methoxyphenyl)methyl]-10-methyl-4-prop-2-enyl-3H-azepino[3,4-b]indole-1,5-dione |
| SMILES | C=CCCC1(CC=C)CN(Cc2ccc(OC)cc2)C(=O)c2c(c3ccccc3n2C)C1=O |
| InChI | InChI=1S/C28H30N2O3/c1-5-7-17-28(16-6-2)19-30(18-20-12-14-21(33-4)15-13-20)27(32)25-24(26(28)31)22-10-8-9-11-23(22)29(25)3/h5-6,8-15H,1-2,7,16-19H2,3-4H3 |
| InChIKey | MBAYNBYYPYYNPK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|