C21H20N2O2 — CID 134959095
(4R)-4-ethenyl-2-[(4-methoxyphenyl)methyl]-3,4-dihydropyrazino[1,2-a]indol-1-one (PubChem CID 134959095) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (4R)-4-ethenyl-2-[(4-methoxyphenyl)methyl]-3,4-dihydropyrazino[1,2-a]indol-1-one.
| Compound Name | (4R)-4-ethenyl-2-[(4-methoxyphenyl)methyl]-3,4-dihydropyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 134959095 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (4R)-4-ethenyl-2-[(4-methoxyphenyl)methyl]-3,4-dihydropyrazino[1,2-a]indol-1-one |
| SMILES | C=C[C@@H]1CN(Cc2ccc(OC)cc2)C(=O)c2cc3ccccc3n21 |
| InChI | InChI=1S/C21H20N2O2/c1-3-17-14-22(13-15-8-10-18(25-2)11-9-15)21(24)20-12-16-6-4-5-7-19(16)23(17)20/h3-12,17H,1,13-14H2,2H3/t17-/m1/s1 |
| InChIKey | NSLVPQFFPRJYNK-QGZVFWFLSA-N |
| XLogP | 4.03 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|