C15H28O5 — CID 132524985
(2S,3R,4S,4aR,6S,8aR)-2,3,4-trimethoxy-6-(2-methylpropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran (PubChem CID 132524985) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is (2S,3R,4S,4aR,6S,8aR)-2,3,4-trimethoxy-6-(2-methylpropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran.
| Compound Name | (2S,3R,4S,4aR,6S,8aR)-2,3,4-trimethoxy-6-(2-methylpropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 132524985 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (2S,3R,4S,4aR,6S,8aR)-2,3,4-trimethoxy-6-(2-methylpropyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran |
| SMILES | CO[C@H]1O[C@@H]2CC[C@@H](CC(C)C)O[C@H]2[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C15H28O5/c1-9(2)8-10-6-7-11-12(19-10)13(16-3)14(17-4)15(18-5)20-11/h9-15H,6-8H2,1-5H3/t10-,11+,12+,13-,14+,15-/m0/s1 |
| InChIKey | QQDGTFOYDDYHFH-MTWVNVMRSA-N |
| XLogP | 1.98 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |