C17H17NO5 — CID 132525720
N,N-diethyl-2'-methyl-3,4'-dioxospiro[2-benzofuran-1,5'-furan]-3'-carboxamide (PubChem CID 132525720) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is N,N-diethyl-2'-methyl-3,4'-dioxospiro[2-benzofuran-1,5'-furan]-3'-carboxamide.
| Compound Name | N,N-diethyl-2'-methyl-3,4'-dioxospiro[2-benzofuran-1,5'-furan]-3'-carboxamide |
|---|---|
| PubChem CID | 132525720 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | N,N-diethyl-2'-methyl-3,4'-dioxospiro[2-benzofuran-1,5'-furan]-3'-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)OC2(OC(=O)c3ccccc32)C1=O |
| InChI | InChI=1S/C17H17NO5/c1-4-18(5-2)15(20)13-10(3)22-17(14(13)19)12-9-7-6-8-11(12)16(21)23-17/h6-9H,4-5H2,1-3H3 |
| InChIKey | ITVUDMTWSQBWLM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|