C21H23BF2O2 — CID 132526772
(E)-2-difluoroboranyloxy-1,3-bis(4-propylphenyl)prop-2-en-1-one (PubChem CID 132526772) has the molecular formula C21H23BF2O2 and a molecular weight of 356.22 g/mol. Its IUPAC name is (E)-2-difluoroboranyloxy-1,3-bis(4-propylphenyl)prop-2-en-1-one.
| Compound Name | (E)-2-difluoroboranyloxy-1,3-bis(4-propylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 132526772 |
| Molecular Formula | C21H23BF2O2 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (E)-2-difluoroboranyloxy-1,3-bis(4-propylphenyl)prop-2-en-1-one |
| SMILES | CCCc1ccc(/C=C(/OB(F)F)C(=O)c2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C21H23BF2O2/c1-3-5-16-7-9-18(10-8-16)15-20(26-22(23)24)21(25)19-13-11-17(6-4-2)12-14-19/h7-15H,3-6H2,1-2H3/b20-15+ |
| InChIKey | XWLCYSFSTHQYCB-HMMYKYKNSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|