C25H21BrFNO4 — CID 132527692
1-benzyl-3-bromo-4-(4-fluorophenyl)-5,6,7-trimethoxyquinolin-2-one (PubChem CID 132527692) has the molecular formula C25H21BrFNO4 and a molecular weight of 498.35 g/mol. Its IUPAC name is 1-benzyl-3-bromo-4-(4-fluorophenyl)-5,6,7-trimethoxyquinolin-2-one.
| Compound Name | 1-benzyl-3-bromo-4-(4-fluorophenyl)-5,6,7-trimethoxyquinolin-2-one |
|---|---|
| PubChem CID | 132527692 |
| Molecular Formula | C25H21BrFNO4 |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 1-benzyl-3-bromo-4-(4-fluorophenyl)-5,6,7-trimethoxyquinolin-2-one |
| SMILES | COc1cc2c(c(OC)c1OC)c(-c1ccc(F)cc1)c(Br)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C25H21BrFNO4/c1-30-19-13-18-21(24(32-3)23(19)31-2)20(16-9-11-17(27)12-10-16)22(26)25(29)28(18)14-15-7-5-4-6-8-15/h4-13H,14H2,1-3H3 |
| InChIKey | FBDILOKQHXWNNJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |