C15H11N5 — CID 132531037
7-(4-methylphenyl)-3,4,6,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene (PubChem CID 132531037) has the molecular formula C15H11N5 and a molecular weight of 261.29 g/mol. Its IUPAC name is 7-(4-methylphenyl)-3,4,6,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene.
| Compound Name | 7-(4-methylphenyl)-3,4,6,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
|---|---|
| PubChem CID | 132531037 |
| Molecular Formula | C15H11N5 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 7-(4-methylphenyl)-3,4,6,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
| SMILES | Cc1ccc(-c2nc3cccnc3c3nncn23)cc1 |
| InChI | InChI=1S/C15H11N5/c1-10-4-6-11(7-5-10)14-18-12-3-2-8-16-13(12)15-19-17-9-20(14)15/h2-9H,1H3 |
| InChIKey | RIIMBNPAVKMHQH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |