C10H6N4O — CID 156697082
3,7,9,14-tetrazatricyclo[8.4.0.02,7]tetradeca-1,3,5,9,11,13-hexaen-8-one (PubChem CID 156697082) has the molecular formula C10H6N4O and a molecular weight of 198.19 g/mol. Its IUPAC name is 3,7,9,14-tetrazatricyclo[8.4.0.02,7]tetradeca-1,3,5,9,11,13-hexaen-8-one.
| Compound Name | 3,7,9,14-tetrazatricyclo[8.4.0.02,7]tetradeca-1,3,5,9,11,13-hexaen-8-one |
|---|---|
| PubChem CID | 156697082 |
| Molecular Formula | C10H6N4O |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 3,7,9,14-tetrazatricyclo[8.4.0.02,7]tetradeca-1,3,5,9,11,13-hexaen-8-one |
| SMILES | O=c1nc2cccnc2c2ncccn12 |
| InChI | InChI=1S/C10H6N4O/c15-10-13-7-3-1-4-11-8(7)9-12-5-2-6-14(9)10/h1-6H |
| InChIKey | RTSQEBBYXVHMSY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|